Source code for rush.auto3d

"""
Auto3D module for the Rush Python client.

Auto3D generates 3D conformers from SMILES strings using the AIMNET
optimizing engine.  It supports configurable conformer counts, convergence
thresholds, and isomer/tautomer enumeration.

Usage::

    from rush import auto3d

    result = auto3d.generate(["CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O"], k=5).fetch()
    print(next(results).stats.e_tot_hartrees)
"""

import sys
from collections.abc import Iterator
from dataclasses import dataclass
from pathlib import Path
from string import Template
from typing import Any, Callable, NewType, Self, TypeGuard, TypeVar

from gql.transport.exceptions import TransportQueryError

from ._rex import bool_to_str, float_to_str
from .mol import TRC
from .objects import RushObject, TRCPaths, TRCRef, _json_content_name, save_json
from .runs import Run, RunOpts, RunSpec
from .session import _submit_rex

# ---------------------------------------------------------------------------
# Result types
# ---------------------------------------------------------------------------


[docs] @dataclass class Stats: f_max: float converged: bool e_rel_kcal_mol: float e_tot_hartrees: float
[docs] @dataclass class Result: conformer: TRC stats: Stats
[docs] @dataclass(frozen=True) class ResultPaths: conformer: TRCPaths stats: Path
Error = NewType("Error", str) T = TypeVar("T") def _is_result_type(result: Any) -> TypeGuard[dict[str, Any]]: return ( isinstance(result, dict) and len(result) == 1 and ("Ok" in result or "Err" in result) ) def _map_outputs( res: list[Any], *, on_success: Callable[[Any], T], ) -> list[T | Error]: return [ # Handle per-conformer error strings Error(res_i) if isinstance(res_i, str) else on_success(res_i) for res_i in res ] @dataclass(frozen=True) class _ConformerRef: """Parsed reference to a single Auto3D conformer.""" trc: TRCRef stats: Stats
[docs] @dataclass(frozen=True) class ResultRef: """Lightweight reference to Auto3D outputs in the Rush object store. Supports indexing and iteration over per-input results:: ref = run.collect() ref[0] # first input's conformers (list[_ConformerRef]) or Error len(ref) # number of inputs Call :meth:`fetch` to download and parse into Python dataclasses, or :meth:`save` to download to local files. """ _inputs: list[list[_ConformerRef] | Error]
[docs] @classmethod def from_raw_output(cls, raw: Any) -> Self: """Parse raw ``collect_run`` output into a ``ResultRef``. The raw output from ``collect_run`` is a ``list[Any]`` where each element is EITHER a string (error) OR a list of ``(trc_objs, stats)`` tuples (conformers), possibly wrapped in ``Ok``/``Err``. We unwrap and parse into typed refs. """ if not isinstance(raw, list): raise ValueError(f"auto3d should return a list, got {type(raw).__name__}.") # Unwrap Ok/Err per element without collapsing single-element lists unwrapped = [ next(iter(item.values())) if _is_result_type(item) else item for item in raw ] def parse_conformers(res_i: Any) -> list[_ConformerRef]: return [ _ConformerRef( trc=TRCRef( topology=RushObject.from_dict(trc_obj[0]), residues=RushObject.from_dict(trc_obj[1]), chains=RushObject.from_dict(trc_obj[2]), ), stats=Stats( stats["f_max"], stats["converged"], stats["e_rel_kcal_mol"], stats["e_tot_hartrees"], ), ) for trc_obj, stats in res_i ] parsed = _map_outputs(unwrapped, on_success=parse_conformers) return cls(_inputs=parsed)
def __getitem__(self, index: int) -> list[_ConformerRef] | Error: return self._inputs[index] def __len__(self) -> int: return len(self._inputs) def __iter__(self) -> Iterator[list[_ConformerRef] | Error]: return iter(self._inputs)
[docs] def fetch(self) -> list[Iterator[Result] | Error]: """Download output files and parse into :class:`Result` objects. Each input SMILES either succeeds (returning an iterator of conformer :class:`Result` objects) or fails (returning an :class:`Error`). Returns: One item per input: either an iterator over fetched conformers or an Error for that input. """ def fetch_output(conformers: list[_ConformerRef]) -> Iterator[Result]: for conf in conformers: yield Result(conformer=conf.trc.fetch(), stats=conf.stats) return _map_outputs(self._inputs, on_success=fetch_output)
[docs] def save(self) -> list[Iterator[ResultPaths] | Error]: """Save Auto3D outputs into the workspace. Each successful input yields an iterator of conformers. Every conformer is saved as three TRC component files ``(topology, residues, chains)`` plus a JSON file containing the associated stats. Returns: One item per input: either an iterator over saved conformers or an Error for that input. """ def save_output(conformers: list[_ConformerRef]) -> Iterator[ResultPaths]: for conf in conformers: yield ResultPaths( conformer=conf.trc.save(), stats=save_json( conf.stats.__dict__, name=_json_content_name("auto3d_stats", conf.stats.__dict__), ), ) return _map_outputs(self._inputs, on_success=save_output)
# --------------------------------------------------------------------------- # Submission # ---------------------------------------------------------------------------
[docs] def generate( smis: list[str], k: int = 1, batchsize_atoms: int = 1024, capacity: int = 40, convergence_threshold: float = 0.003, enumerate_isomer: bool = True, enumerate_tautomer: bool = False, max_confs: int | None = None, opt_steps: int = 5000, patience: int = 1000, threshold: float = 0.3, run_spec: RunSpec = RunSpec(), run_opts: RunOpts = RunOpts(), ) -> Run[ResultRef]: """ Submit an Auto3D conformer generation job for a list of SMILES strings. Returns a :class:`~rush.runs.Run` handle. Call ``.collect()`` to wait for the result ref, then ``.fetch()`` or ``.save()`` to retrieve outputs. """ rex = Template("""let auto3d = λ smis → try_auto3d_rex default_runspec_gpu (auto3d_rex::Auto3dOptions { k = Some (int $k), batchsize_atoms = Some $batchsize_atoms, capacity = Some $capacity, convergence_threshold = Some $convergence_threshold, enumerate_isomer = Some $enumerate_isomer, enumerate_tautomer = Some $enumerate_tautomer, job_name = None, max_confs = $max_confs, memory = None, mpi_np = Some 4, opt_steps = Some $opt_steps, optimizing_engine = Some auto3d_rex::Auto3dOptimizingEngines::AIMNET, patience = Some $patience, threshold = Some $threshold, verbose = Some false, window = None, }) $smis in auto3d $smis """).substitute( smis=f"[{', '.join([f'"{smi}"' for smi in smis])}]", k=k, batchsize_atoms=batchsize_atoms, capacity=capacity, convergence_threshold=float_to_str(convergence_threshold), enumerate_isomer=bool_to_str(enumerate_isomer), enumerate_tautomer=bool_to_str(enumerate_tautomer), max_confs=max_confs, opt_steps=opt_steps, patience=patience, threshold=float_to_str(threshold), run_spec=run_spec._to_rex(), ) try: return Run(_submit_rex(rex, run_opts), ResultRef) except TransportQueryError as e: if e.errors: print("Error:", file=sys.stderr) for error in e.errors: print(f" {error['message']}", file=sys.stderr) raise